CAS 2404733-75-9 is the registry number for 3-Bromo-2-isopropoxy-5-isopropylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
3-bromo-5-propan-2-yl-2-propan-2-yloxybenzoic acid (CAS 2404733-75-9) is a chemical compound with the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. IUPAC name: 3-bromo-5-propan-2-yl-2-propan-2-yloxybenzoic acid. InChIKey: IQFSLRSBMOKARA-UHFFFAOYSA-N.
| Molecular formula | C13H17BrO3 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | 3-bromo-5-propan-2-yl-2-propan-2-yloxybenzoic acid |
| InChIKey | IQFSLRSBMOKARA-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Br)OC(C)C)C(=O)O |
Computed by PubChem (NCBI)