CAS 2504202-20-2 is the registry number for 4-((3-Bromo-4-methylphenoxy)methyl)-2,2-dimethyl-1,3-dioxolane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(3-bromo-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane (CAS 2504202-20-2) is a chemical compound with the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. IUPAC name: 4-[(3-bromo-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane. InChIKey: PSAQLWAFXVNJGC-UHFFFAOYSA-N.
| Molecular formula | C13H17BrO3 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | 4-[(3-bromo-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane |
| InChIKey | PSAQLWAFXVNJGC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OCC2COC(O2)(C)C)Br |
Computed by PubChem (NCBI)