Products 203071-50-5

CAS 203071-50-5 is the registry number for 2-(4-((5-Bromopentyl)oxy)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[4-(5-bromopentoxy)phenyl]acetic acid (CAS 203071-50-5) is a chemical compound with the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. IUPAC name: 2-[4-(5-bromopentoxy)phenyl]acetic acid. InChIKey: JSZVLKADKPMUBU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17BrO3
Molecular weight301.18 g/mol
IUPAC name2-[4-(5-bromopentoxy)phenyl]acetic acid
InChIKeyJSZVLKADKPMUBU-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CC(=O)O)OCCCCCBr

Computed by PubChem (NCBI)