Products 2202948-74-9

CAS 2202948-74-9 is the registry number for 3-(4-Bromophenoxy)-2,2-dimethyl-propionic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 3-(4-bromophenoxy)-2,2-dimethylpropanoate (CAS 2202948-74-9) is a chemical compound with the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. IUPAC name: ethyl 3-(4-bromophenoxy)-2,2-dimethylpropanoate. InChIKey: IFFHYCGHZLVBNN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17BrO3
Molecular weight301.18 g/mol
IUPAC nameethyl 3-(4-bromophenoxy)-2,2-dimethylpropanoate
InChIKeyIFFHYCGHZLVBNN-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(C)COC1=CC=C(C=C1)Br

Computed by PubChem (NCBI)