CAS 2379322-21-9 appears in our catalog under these names: tert-Butyl 3-bromo-5-ethoxybenzoate, 95%, tert-Butyl 3-bromo-5-ethoxybenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
Tert-butyl 3-bromo-5-ethoxybenzoate (CAS 2379322-21-9) is a chemical compound with the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. IUPAC name: tert-butyl 3-bromo-5-ethoxybenzoate. InChIKey: JPBULQBYWCWNGA-UHFFFAOYSA-N.
| Molecular formula | C13H17BrO3 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | tert-butyl 3-bromo-5-ethoxybenzoate |
| InChIKey | JPBULQBYWCWNGA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=C1)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)