CAS 179950-75-5 is the registry number for Methyl 2,2-dimethyl-3-oxo-3,4-dihydro-2h-1,4-benzoxazine-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carboxylate (CAS 179950-75-5) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: methyl 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carboxylate. InChIKey: IQIROGMGFBKEFU-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | methyl 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carboxylate |
| InChIKey | IQIROGMGFBKEFU-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=CC(=C2)C(=O)OC)C |
Computed by PubChem (NCBI)