CAS 887268-36-2 is the registry number for 1-Fluoro-4-(1,1,2,2-tetrafluoroethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-fluoro-4-(1,1,2,2-tetrafluoroethoxy)benzene (CAS 887268-36-2) is a chemical compound with the molecular formula C8H5F5O and a molecular weight of 212.12 g/mol. IUPAC name: 1-fluoro-4-(1,1,2,2-tetrafluoroethoxy)benzene. InChIKey: HGSJHYRBXANKCM-UHFFFAOYSA-N.
| Molecular formula | C8H5F5O |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | 1-fluoro-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| InChIKey | HGSJHYRBXANKCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(C(F)F)(F)F)F |
Computed by PubChem (NCBI)