Products 180031-03-2
CAS 180031-03-2 is the registry number for 5-Isopropylpyridine-2-sulfonyl chloride, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
5-propan-2-ylpyridine-2-sulfonyl chloride (CAS 180031-03-2) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: 5-propan-2-ylpyridine-2-sulfonyl chloride. InChIKey: JSBVVLSVARQKMS-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 5-propan-2-ylpyridine-2-sulfonyl chloride |
| InChIKey | JSBVVLSVARQKMS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CN=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)