Products 1801324-41-3
CAS 1801324-41-3 is the registry number for CREBBP-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(5-acetyl-2-ethoxyphenyl)carbamoyl]benzoic acid (CAS 1801324-41-3) is a chemical compound with the molecular formula C18H17NO5 and a molecular weight of 327.3 g/mol. IUPAC name: 3-[(5-acetyl-2-ethoxyphenyl)carbamoyl]benzoic acid. InChIKey: GFOBMGVVDGTGAJ-UHFFFAOYSA-N.
| Molecular formula | C18H17NO5 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | 3-[(5-acetyl-2-ethoxyphenyl)carbamoyl]benzoic acid |
| InChIKey | GFOBMGVVDGTGAJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(=O)C)NC(=O)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)