CAS 180160-47-8 appears in our catalog under these names: 5-Chloro-3h-spiro[isobenzofuran-1,4'-piperidin]-3-one hydrochloride, 95%, 5–CHLORO–3H–SPIRO(ISOBENZOFURAN–1,4'–PIPERIDIN)–3–ONE HCL, 5-Chloro-3h-spiro[isobenzofuran-1,4'-piperidin]-3-one, HCl, 95%, 95%, 5-Chloro-3H-spiro[isobenzofuran-1,4'-piperidin]-3-one, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one (CAS 180160-47-8) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one. InChIKey: SIUBZWCKBKOZMD-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one |
| InChIKey | SIUBZWCKBKOZMD-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=C(C=C3)Cl)C(=O)O2 |
Computed by PubChem (NCBI)