Products 180336-50-9

CAS 180336-50-9 is the registry number for N-benzyl-3-(1,3-dioxolan-2-yl)aniline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

N-benzyl-3-(1,3-dioxolan-2-yl)aniline (CAS 180336-50-9) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: N-benzyl-3-(1,3-dioxolan-2-yl)aniline. InChIKey: ISDGXMSVHFIAON-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17NO2
Molecular weight255.31 g/mol
IUPAC nameN-benzyl-3-(1,3-dioxolan-2-yl)aniline
InChIKeyISDGXMSVHFIAON-UHFFFAOYSA-N
SMILESC1COC(O1)C2=CC(=CC=C2)NCC3=CC=CC=C3

Computed by PubChem (NCBI)