CAS 180340-64-1 appears in our catalog under these names: 5-Oxo-4h,5h,6h,7h,8h-furo(3,2-b)azepine-3-carboxylic acid, 95%, 5-Oxo-4H,5H,6H,7H,8H-furo(3,2-b)azepine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-oxo-4,6,7,8-tetrahydrofuro[3,2-b]azepine-3-carboxylic acid (CAS 180340-64-1) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 5-oxo-4,6,7,8-tetrahydrofuro[3,2-b]azepine-3-carboxylic acid. InChIKey: FJXIXGUIQHTUSS-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 5-oxo-4,6,7,8-tetrahydrofuro[3,2-b]azepine-3-carboxylic acid |
| InChIKey | FJXIXGUIQHTUSS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CO2)C(=O)O)NC(=O)C1 |
Computed by PubChem (NCBI)