CAS 1803562-80-2 appears in our catalog under these names: Methyl 2-amino-2-(1-phenyl-1H-pyrazol-4-yl)acetate hydrochloride, Methyl 2-amino-2-(1-phenyl-1H-pyrazol-4-yl)acetate hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
Methyl 2-amino-2-(1-phenylpyrazol-4-yl)acetate;hydrochloride (CAS 1803562-80-2) is a chemical compound with the molecular formula C12H14ClN3O2 and a molecular weight of 267.71 g/mol. IUPAC name: methyl 2-amino-2-(1-phenylpyrazol-4-yl)acetate;hydrochloride. InChIKey: BIMWYJNEPDRYSU-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O2 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | methyl 2-amino-2-(1-phenylpyrazol-4-yl)acetate;hydrochloride |
| InChIKey | BIMWYJNEPDRYSU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CN(N=C1)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)