Products 1803565-70-9
CAS 1803565-70-9 is the registry number for 2-Amino-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide;hydrochloride (CAS 1803565-70-9) is a chemical compound with the molecular formula C10H13ClN2O3 and a molecular weight of 244.67 g/mol. IUPAC name: 2-amino-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide;hydrochloride. InChIKey: GENOUJGYSGSXQC-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O3 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 2-amino-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide;hydrochloride |
| InChIKey | GENOUJGYSGSXQC-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(C(=O)N)N.Cl |
Computed by PubChem (NCBI)