CAS 1803572-00-0 appears in our catalog under these names: 4-Amino-1,2,3,5,6,7-hexahydro-S-indacen-1-one, 4-Amino-3,5,6,7-tetrahydro-s-indacen-1(2H)-one, 95%. Offered by: Biosynth, Ambeed, BLDpharm. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
4-amino-3,5,6,7-tetrahydro-2H-s-indacen-1-one (CAS 1803572-00-0) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 4-amino-3,5,6,7-tetrahydro-2H-s-indacen-1-one. InChIKey: MQAJAZOCBPUPAP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 4-amino-3,5,6,7-tetrahydro-2H-s-indacen-1-one |
| InChIKey | MQAJAZOCBPUPAP-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(CCC3=O)C(=C2C1)N |
Computed by PubChem (NCBI)