CAS 1803584-50-0 is the registry number for 4-Methyl-6-(trifluoromethyl)pyridin-3-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-methyl-6-(trifluoromethyl)pyridin-3-amine;hydrochloride (CAS 1803584-50-0) is a chemical compound with the molecular formula C7H8ClF3N2 and a molecular weight of 212.60 g/mol. IUPAC name: 4-methyl-6-(trifluoromethyl)pyridin-3-amine;hydrochloride. InChIKey: RURLZUQGSPQWQA-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2 |
|---|---|
| Molecular weight | 212.60 g/mol |
| IUPAC name | 4-methyl-6-(trifluoromethyl)pyridin-3-amine;hydrochloride |
| InChIKey | RURLZUQGSPQWQA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)