Products 1803592-54-2
CAS 1803592-54-2 is the registry number for 1-(2,2-Difluoroethyl)piperidine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(2,2-difluoroethyl)piperidine-3-carboxylic acid;hydrochloride (CAS 1803592-54-2) is a chemical compound with the molecular formula C8H14ClF2NO2 and a molecular weight of 229.65 g/mol. IUPAC name: 1-(2,2-difluoroethyl)piperidine-3-carboxylic acid;hydrochloride. InChIKey: KSAWDITYZNTZRR-UHFFFAOYSA-N.
| Molecular formula | C8H14ClF2NO2 |
|---|---|
| Molecular weight | 229.65 g/mol |
| IUPAC name | 1-(2,2-difluoroethyl)piperidine-3-carboxylic acid;hydrochloride |
| InChIKey | KSAWDITYZNTZRR-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC(F)F)C(=O)O.Cl |
Computed by PubChem (NCBI)