Products 2260932-75-8

CAS 2260932-75-8 is the registry number for 2-(5,5-Difluoroazepan-4-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(5,5-difluoroazepan-4-yl)acetic acid;hydrochloride (CAS 2260932-75-8) is a chemical compound with the molecular formula C8H14ClF2NO2 and a molecular weight of 229.65 g/mol. IUPAC name: 2-(5,5-difluoroazepan-4-yl)acetic acid;hydrochloride. InChIKey: ZTFXTBVDLNNHPH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClF2NO2
Molecular weight229.65 g/mol
IUPAC name2-(5,5-difluoroazepan-4-yl)acetic acid;hydrochloride
InChIKeyZTFXTBVDLNNHPH-UHFFFAOYSA-N
SMILESC1CNCCC(C1CC(=O)O)(F)F.Cl

Computed by PubChem (NCBI)