CAS 1803592-74-6 appears in our catalog under these names: Ethyl 3-amino-3-cyclopropyl-2,2-difluoropropanoate hydrochloride, 95%, Ethyl 3-amino-3-cyclopropyl-2,2-difluoropropanoate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl 3-amino-3-cyclopropyl-2,2-difluoropropanoate;hydrochloride (CAS 1803592-74-6) is a chemical compound with the molecular formula C8H14ClF2NO2 and a molecular weight of 229.65 g/mol. IUPAC name: ethyl 3-amino-3-cyclopropyl-2,2-difluoropropanoate;hydrochloride. InChIKey: IMFSDKLJZQVOFZ-UHFFFAOYSA-N.
| Molecular formula | C8H14ClF2NO2 |
|---|---|
| Molecular weight | 229.65 g/mol |
| IUPAC name | ethyl 3-amino-3-cyclopropyl-2,2-difluoropropanoate;hydrochloride |
| InChIKey | IMFSDKLJZQVOFZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C1CC1)N)(F)F.Cl |
Computed by PubChem (NCBI)