CAS 2250243-69-5 appears in our catalog under these names: (2R)-2-Amino-2-(4,4-difluorocyclohexyl)acetic acid hydrochloride, 95%, (R)-2-Amino-2-(4,4-difluorocyclohexyl)acetic acid hydrochloride, 97%, (2R)-2-amino-2-(4,4-difluorocyclohexyl)acetic acid hydrochloride, 97%, 97%, (2R)-2-AMINO-2-(4,4-DIFLUOROCYCLOHEXYL)ACETIC ACID HCL, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg.
(2R)-2-amino-2-(4,4-difluorocyclohexyl)acetic acid;hydrochloride (CAS 2250243-69-5) is a chemical compound with the molecular formula C8H14ClF2NO2 and a molecular weight of 229.65 g/mol. IUPAC name: (2R)-2-amino-2-(4,4-difluorocyclohexyl)acetic acid;hydrochloride. InChIKey: YLJOKBLTFFPVBF-FYZOBXCZSA-N.
| Molecular formula | C8H14ClF2NO2 |
|---|---|
| Molecular weight | 229.65 g/mol |
| IUPAC name | (2R)-2-amino-2-(4,4-difluorocyclohexyl)acetic acid;hydrochloride |
| InChIKey | YLJOKBLTFFPVBF-FYZOBXCZSA-N |
| SMILES | C1CC(CCC1[C@H](C(=O)O)N)(F)F.Cl |
Computed by PubChem (NCBI)