CAS 2231665-41-9 appears in our catalog under these names: (S)-2-Amino-2-(4,4-difluorocyclohexyl)acetic acid hydrochloride, 97%, (S)-2-Amino-2-(4,4-difluorocyclohexyl)acetic acid hydrochloride, 97%, 97%, (S)-2-Amino-2-(4,4-difluorocyclohexyl)acetic acid hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg.
(2S)-2-amino-2-(4,4-difluorocyclohexyl)acetic acid;hydrochloride (CAS 2231665-41-9) is a chemical compound with the molecular formula C8H14ClF2NO2 and a molecular weight of 229.65 g/mol. IUPAC name: (2S)-2-amino-2-(4,4-difluorocyclohexyl)acetic acid;hydrochloride. InChIKey: YLJOKBLTFFPVBF-RGMNGODLSA-N.
| Molecular formula | C8H14ClF2NO2 |
|---|---|
| Molecular weight | 229.65 g/mol |
| IUPAC name | (2S)-2-amino-2-(4,4-difluorocyclohexyl)acetic acid;hydrochloride |
| InChIKey | YLJOKBLTFFPVBF-RGMNGODLSA-N |
| SMILES | C1CC(CCC1[C@@H](C(=O)O)N)(F)F.Cl |
Computed by PubChem (NCBI)