Products 2270905-94-5

CAS 2270905-94-5 is the registry number for 4-(3,3-Difluoro-pyrrolidin-1-yl)-butyric acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(3,3-difluoropyrrolidin-1-yl)butanoic acid;hydrochloride (CAS 2270905-94-5) is a chemical compound with the molecular formula C8H14ClF2NO2 and a molecular weight of 229.65 g/mol. IUPAC name: 4-(3,3-difluoropyrrolidin-1-yl)butanoic acid;hydrochloride. InChIKey: DURUXDOUPAJQIK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClF2NO2
Molecular weight229.65 g/mol
IUPAC name4-(3,3-difluoropyrrolidin-1-yl)butanoic acid;hydrochloride
InChIKeyDURUXDOUPAJQIK-UHFFFAOYSA-N
SMILESC1CN(CC1(F)F)CCCC(=O)O.Cl

Computed by PubChem (NCBI)