CAS 2260936-17-0 is the registry number for 2-(1-Amino-4,4-difluorocyclohexyl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(1-amino-4,4-difluorocyclohexyl)acetic acid;hydrochloride (CAS 2260936-17-0) is a chemical compound with the molecular formula C8H14ClF2NO2 and a molecular weight of 229.65 g/mol. IUPAC name: 2-(1-amino-4,4-difluorocyclohexyl)acetic acid;hydrochloride. InChIKey: RKOMSCXFZZFWQS-UHFFFAOYSA-N.
| Molecular formula | C8H14ClF2NO2 |
|---|---|
| Molecular weight | 229.65 g/mol |
| IUPAC name | 2-(1-amino-4,4-difluorocyclohexyl)acetic acid;hydrochloride |
| InChIKey | RKOMSCXFZZFWQS-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1(CC(=O)O)N)(F)F.Cl |
Computed by PubChem (NCBI)