CAS 1803592-84-8 appears in our catalog under these names: tert-Butyl 3-amino-1H-1,2,4-triazole-1-carboxylate, tert-Butyl 3-amino-1H-1,2,4-triazole-1-carboxylate, 95%, 95%, tert-Butyl 3-amino-1H-1,2,4-triazole-1-carboxylate, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
Tert-butyl 3-amino-1,2,4-triazole-1-carboxylate (CAS 1803592-84-8) is a chemical compound with the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. IUPAC name: tert-butyl 3-amino-1,2,4-triazole-1-carboxylate. InChIKey: FJXSRCUWKNZLHE-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | tert-butyl 3-amino-1,2,4-triazole-1-carboxylate |
| InChIKey | FJXSRCUWKNZLHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=NC(=N1)N |
Computed by PubChem (NCBI)