Products 1803593-33-0
CAS 1803593-33-0 appears in our catalog under these names: 3-(1,1-Difluoroethyl)aniline hydrochloride, 95%, 3-(1,1-Difluoroethyl)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 0,5g.
3-(1,1-difluoroethyl)aniline;hydrochloride (CAS 1803593-33-0) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: 3-(1,1-difluoroethyl)aniline;hydrochloride. InChIKey: LFNOZSMYWPJAHO-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | 3-(1,1-difluoroethyl)aniline;hydrochloride |
| InChIKey | LFNOZSMYWPJAHO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)N)(F)F.Cl |
Computed by PubChem (NCBI)