Products 1803598-59-5
CAS 1803598-59-5 is the registry number for 3,3,3-Trifluoro-1-(4-methylphenyl)propan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,3,3-trifluoro-1-(4-methylphenyl)propan-1-amine;hydrochloride (CAS 1803598-59-5) is a chemical compound with the molecular formula C10H13ClF3N and a molecular weight of 239.66 g/mol. IUPAC name: 3,3,3-trifluoro-1-(4-methylphenyl)propan-1-amine;hydrochloride. InChIKey: FWSQAMLTIGWUAC-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF3N |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | 3,3,3-trifluoro-1-(4-methylphenyl)propan-1-amine;hydrochloride |
| InChIKey | FWSQAMLTIGWUAC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(CC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)