CAS 1803600-24-9 appears in our catalog under these names: 2-Amino-3-(pyridin-3-yl) Propan-1-ol Dihydrochloride, 2-Amino-3-(pyridin-3-yl)propan-1-ol dihydrochloride, 2-Amino-3-(pyridin-3-yl)propan-1-ol dihydrochloride, 95%, 95%, 2-Amino-3-(pyridin-3-yl)propan-1-ol dihydrochloride, 95%. Offered by: Chemat Brand, Biosynth, Chemat, Fluorochem. Available pack sizes: on request, 5g, 0,5g, 100mg, 250mg, 1g.
2-amino-3-pyridin-3-ylpropan-1-ol;dihydrochloride (CAS 1803600-24-9) is a chemical compound with the molecular formula C8H14Cl2N2O and a molecular weight of 225.11 g/mol. IUPAC name: 2-amino-3-pyridin-3-ylpropan-1-ol;dihydrochloride. InChIKey: QSRDSPZSRCLBJP-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | 2-amino-3-pyridin-3-ylpropan-1-ol;dihydrochloride |
| InChIKey | QSRDSPZSRCLBJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CC(CO)N.Cl.Cl |
Computed by PubChem (NCBI)