CAS 1803608-14-1 appears in our catalog under these names: 2,4-Dichloro-6-(dimethylamino)benzaldehyde, 95%, 2,4-Dichloro-6-(dimethylamino)benzaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,4-dichloro-6-(dimethylamino)benzaldehyde (CAS 1803608-14-1) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: 2,4-dichloro-6-(dimethylamino)benzaldehyde. InChIKey: OUGIHRDVCSBNIV-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 2,4-dichloro-6-(dimethylamino)benzaldehyde |
| InChIKey | OUGIHRDVCSBNIV-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=CC(=C1)Cl)Cl)C=O |
Computed by PubChem (NCBI)