Products 1803609-01-9
CAS 1803609-01-9 is the registry number for 1-(5-(Phenoxymethyl)-1,3,4-oxadiazol-2-yl)ethan-1-amine, oxalic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Oxalic acid;1-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]ethanamine (CAS 1803609-01-9) is a chemical compound with the molecular formula C13H15N3O6 and a molecular weight of 309.27 g/mol. IUPAC name: oxalic acid;1-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]ethanamine. InChIKey: PEPXOHYZMYYTLM-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O6 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | oxalic acid;1-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]ethanamine |
| InChIKey | PEPXOHYZMYYTLM-UHFFFAOYSA-N |
| SMILES | CC(C1=NN=C(O1)COC2=CC=CC=C2)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)