CAS 1803609-66-6 appears in our catalog under these names: 4-(Aminomethyl)phenyl acetate hydrochloride, 95%, 4-(Aminomethyl)phenyl acetate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 100mg, 250mg, 1g, 0,5g, 50mg.
[4-(aminomethyl)phenyl] acetate;hydrochloride (CAS 1803609-66-6) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: [4-(aminomethyl)phenyl] acetate;hydrochloride. InChIKey: HSBFTMPAEWDKGE-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | [4-(aminomethyl)phenyl] acetate;hydrochloride |
| InChIKey | HSBFTMPAEWDKGE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)