Products 1803820-00-9
CAS 1803820-00-9 is the registry number for 5-Fluoro-2-methyl-4-nitrobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
5-fluoro-2-methyl-4-nitrobenzoic acid (CAS 1803820-00-9) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 5-fluoro-2-methyl-4-nitrobenzoic acid. InChIKey: SSKFBMBDDWDANR-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 5-fluoro-2-methyl-4-nitrobenzoic acid |
| InChIKey | SSKFBMBDDWDANR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
5-Fluoro-2-methyl-4-nitrobenzoic acid