CAS 1804099-90-8 is the registry number for Ethyl 6-nitronicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 6-nitropyridine-3-carboxylate (CAS 1804099-90-8) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: ethyl 6-nitropyridine-3-carboxylate. InChIKey: KHZWYUMLAYVIQN-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | ethyl 6-nitropyridine-3-carboxylate |
| InChIKey | KHZWYUMLAYVIQN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)