Products 1804145-98-9
CAS 1804145-98-9 appears in our catalog under these names: 2-chloro-7-(trifluoromethyl)-1,3-benzoxazole, 97%, 97%, 2-Chloro-7-(trifluoromethyl)benzo[d]oxazole, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-chloro-7-(trifluoromethyl)-1,3-benzoxazole (CAS 1804145-98-9) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 2-chloro-7-(trifluoromethyl)-1,3-benzoxazole. InChIKey: PSFIIJPPRKWDTI-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 2-chloro-7-(trifluoromethyl)-1,3-benzoxazole |
| InChIKey | PSFIIJPPRKWDTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)N=C(O2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)