CAS 1804896-29-4 is the registry number for ethyl 2,4-dichloro-5-methylbenzoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 2,4-dichloro-5-methylbenzoate (CAS 1804896-29-4) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: ethyl 2,4-dichloro-5-methylbenzoate. InChIKey: WCLQKLZRHLJNMU-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | ethyl 2,4-dichloro-5-methylbenzoate |
| InChIKey | WCLQKLZRHLJNMU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C(=C1)C)Cl)Cl |
Computed by PubChem (NCBI)