CAS 54415-82-6 is the registry number for Diethyl 2–(3–nitropyridin–4–yl)malonate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Diethyl 2-(3-nitro-4-pyridinyl)propanedioate (CAS 54415-82-6) is a chemical compound with the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. IUPAC name: diethyl 2-(3-nitro-4-pyridinyl)propanedioate. InChIKey: LAVQMCRFEBZEEH-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O6 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | diethyl 2-(3-nitro-4-pyridinyl)propanedioate |
| InChIKey | LAVQMCRFEBZEEH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C=NC=C1)[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)