Products 54415-82-6

CAS 54415-82-6 is the registry number for Diethyl 2–(3–nitropyridin–4–yl)malonate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Diethyl 2-(3-nitro-4-pyridinyl)propanedioate (CAS 54415-82-6) is a chemical compound with the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. IUPAC name: diethyl 2-(3-nitro-4-pyridinyl)propanedioate. InChIKey: LAVQMCRFEBZEEH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O6
Molecular weight282.25 g/mol
IUPAC namediethyl 2-(3-nitro-4-pyridinyl)propanedioate
InChIKeyLAVQMCRFEBZEEH-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=C(C=NC=C1)[N+](=O)[O-])C(=O)OCC

Computed by PubChem (NCBI)