CAS 1805601-57-3 is the registry number for Apalutamide Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3-(trifluoromethyl)pyridine-2-carbonitrile (CAS 1805601-57-3) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 4-amino-3-(trifluoromethyl)pyridine-2-carbonitrile. InChIKey: CIYLYFTZMOMXFC-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 4-amino-3-(trifluoromethyl)pyridine-2-carbonitrile |
| InChIKey | CIYLYFTZMOMXFC-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1N)C(F)(F)F)C#N |
Computed by PubChem (NCBI)