Products 1805930-73-7
CAS 1805930-73-7 is the registry number for Methyl 5-amino-4,6-dichloropicolinate, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg.
Methyl 5-amino-4,6-dichloropyridine-2-carboxylate (CAS 1805930-73-7) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: methyl 5-amino-4,6-dichloropyridine-2-carboxylate. InChIKey: NRVIZFGDZANPDQ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2 |
|---|---|
| Molecular weight | 221.04 g/mol |
| IUPAC name | methyl 5-amino-4,6-dichloropyridine-2-carboxylate |
| InChIKey | NRVIZFGDZANPDQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C(C(=C1)Cl)N)Cl |
Computed by PubChem (NCBI)