Products 1806773-44-3
CAS 1806773-44-3 is the registry number for Methyl 5-(difluoromethyl)-6-methyl-2-pyridinecarboxylate, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
Methyl 5-(difluoromethyl)-6-methylpyridine-2-carboxylate (CAS 1806773-44-3) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: methyl 5-(difluoromethyl)-6-methylpyridine-2-carboxylate. InChIKey: RPYJDPFLQQXECI-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | methyl 5-(difluoromethyl)-6-methylpyridine-2-carboxylate |
| InChIKey | RPYJDPFLQQXECI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C(=O)OC)C(F)F |
Computed by PubChem (NCBI)