Products 1807080-41-6
CAS 1807080-41-6 is the registry number for methyl 3-bromo-6-fluoro-2-hydroxybenzoate, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
Methyl 3-bromo-6-fluoro-2-hydroxybenzoate (CAS 1807080-41-6) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: methyl 3-bromo-6-fluoro-2-hydroxybenzoate. InChIKey: MEIUGXXINDWKRU-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | methyl 3-bromo-6-fluoro-2-hydroxybenzoate |
| InChIKey | MEIUGXXINDWKRU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1O)Br)F |
Computed by PubChem (NCBI)