CAS 1807144-89-3 is the registry number for methyl 4-bromo-2-fluoro-5-hydroxybenzoate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 4-bromo-2-fluoro-5-hydroxybenzoate (CAS 1807144-89-3) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: methyl 4-bromo-2-fluoro-5-hydroxybenzoate. InChIKey: AMHHBRMZDXMAEP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | methyl 4-bromo-2-fluoro-5-hydroxybenzoate |
| InChIKey | AMHHBRMZDXMAEP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)Br)O |
Computed by PubChem (NCBI)