Products 1807158-83-3
CAS 1807158-83-3 is the registry number for 2-Amino-6-(trifluoromethyl)isonicotinonitrile, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
2-amino-6-(trifluoromethyl)pyridine-4-carbonitrile (CAS 1807158-83-3) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 2-amino-6-(trifluoromethyl)pyridine-4-carbonitrile. InChIKey: YNCSUEJINXCKST-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 2-amino-6-(trifluoromethyl)pyridine-4-carbonitrile |
| InChIKey | YNCSUEJINXCKST-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)N)C#N |
Computed by PubChem (NCBI)