CAS 1807938-27-7 is the registry number for N-{(2-(Phenoxymethyl)-1,3-thiazol-4-yl)methylidene}hydroxylamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(NE)-N-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methylidene]hydroxylamine (CAS 1807938-27-7) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: (NE)-N-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methylidene]hydroxylamine. InChIKey: FSVATIOOWRUXNH-WUXMJOGZSA-N.
| Molecular formula | C11H10N2O2S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | (NE)-N-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methylidene]hydroxylamine |
| InChIKey | FSVATIOOWRUXNH-WUXMJOGZSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=NC(=CS2)/C=N/O |
Computed by PubChem (NCBI)