CAS 1807939-55-4 is the registry number for rac-(2R,3S)-4-Ethyl-5-oxo-3-phenylmorpholine-2-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S,3R)-4-ethyl-5-oxo-3-phenylmorpholine-2-carboxamide (CAS 1807939-55-4) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: (2S,3R)-4-ethyl-5-oxo-3-phenylmorpholine-2-carboxamide. InChIKey: NBILJQGMAXBBCA-NEPJUHHUSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | (2S,3R)-4-ethyl-5-oxo-3-phenylmorpholine-2-carboxamide |
| InChIKey | NBILJQGMAXBBCA-NEPJUHHUSA-N |
| SMILES | CCN1[C@@H]([C@H](OCC1=O)C(=O)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)