CAS 1808008-21-0 is the registry number for 6-Bromo-2-methoxyquinoline-3-carbaldehyde, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
6-bromo-2-methoxyquinoline-3-carbaldehyde (CAS 1808008-21-0) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: 6-bromo-2-methoxyquinoline-3-carbaldehyde. InChIKey: FTPCVGOKWCGORL-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 6-bromo-2-methoxyquinoline-3-carbaldehyde |
| InChIKey | FTPCVGOKWCGORL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=C(C=CC2=N1)Br)C=O |
Computed by PubChem (NCBI)