Products 180991-02-0
CAS 180991-02-0 is the registry number for L-Glutamine-2-13C. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(2S)-2,5-diamino-5-oxo(213C)pentanoic acid (CAS 180991-02-0) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 147.14 g/mol. IUPAC name: (2S)-2,5-diamino-5-oxo(213C)pentanoic acid. InChIKey: ZDXPYRJPNDTMRX-CGEPYFIDSA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 147.14 g/mol |
| IUPAC name | (2S)-2,5-diamino-5-oxo(213C)pentanoic acid |
| InChIKey | ZDXPYRJPNDTMRX-CGEPYFIDSA-N |
| SMILES | C(CC(=O)N)[13C@@H](C(=O)O)N |
Computed by PubChem (NCBI)