Products 181021-86-3
CAS 181021-86-3 appears in our catalog under these names: 2-Oxo-1,2,5,6,7,8-hexahydroquinoline-4-carboxylic acid, 2-Oxo-1,2,5,6,7,8-hexahydroquinoline-4-carboxylic Acid, >95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g, 10g.
2-oxo-5,6,7,8-tetrahydro-1H-quinoline-4-carboxylic acid (CAS 181021-86-3) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 2-oxo-5,6,7,8-tetrahydro-1H-quinoline-4-carboxylic acid. InChIKey: UHPGAHWIJWPXEA-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2-oxo-5,6,7,8-tetrahydro-1H-quinoline-4-carboxylic acid |
| InChIKey | UHPGAHWIJWPXEA-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=CC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)