CAS 181653-90-7 is the registry number for 3-(Hydroxyimino)-5-methyl-2,3-dihydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 10g, 1g.
5-methyl-3-nitroso-1H-indol-2-ol (CAS 181653-90-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 5-methyl-3-nitroso-1H-indol-2-ol. InChIKey: KVSDYOWXCHPWQI-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 5-methyl-3-nitroso-1H-indol-2-ol |
| InChIKey | KVSDYOWXCHPWQI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=C2N=O)O |
Computed by PubChem (NCBI)