Products 1820579-80-3
CAS 1820579-80-3 appears in our catalog under these names: (R)-6-Chloro-2,3-dihydrobenzo[b][1,4]dioxine-2-carboxylic acid, 95%, (R)-6-Chloro-2,3-dihydrobenzo(b)(1,4)dioxine-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(2R)-6-chloro-2,3-dihydro-1,4-benzodioxine-2-carboxylic acid (CAS 1820579-80-3) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: (2R)-6-chloro-2,3-dihydro-1,4-benzodioxine-2-carboxylic acid. InChIKey: MNHNWDHFZWYPIJ-MRVPVSSYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | (2R)-6-chloro-2,3-dihydro-1,4-benzodioxine-2-carboxylic acid |
| InChIKey | MNHNWDHFZWYPIJ-MRVPVSSYSA-N |
| SMILES | C1[C@@H](OC2=C(O1)C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)