CAS 431888-57-2 appears in our catalog under these names: 2–Chloro–4–(methoxycarbonyl)benzoic acid, 2-Chloro-4-(methoxycarbonyl)benzoic acid, 2-Chloro-4-(methoxycarbonyl)benzoic acid, 96%, 2-Chloro-4-(methoxycarbonyl)benzoic acid 95%, 2-Chloro-4-(methoxycarbonyl)benzoic acid, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 2,5g, 10g, 25g, 100mg.
2-chloro-4-methoxycarbonylbenzoic acid (CAS 431888-57-2) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: 2-chloro-4-methoxycarbonylbenzoic acid. InChIKey: ICUITMASTQNLIL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 2-chloro-4-methoxycarbonylbenzoic acid |
| InChIKey | ICUITMASTQNLIL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)