Products 2352756-94-4

CAS 2352756-94-4 is the registry number for 3-(2-Chloro-5-hydroxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2-chloro-5-hydroxyphenyl)-2-oxopropanoic acid (CAS 2352756-94-4) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: 3-(2-chloro-5-hydroxyphenyl)-2-oxopropanoic acid. InChIKey: JFPSFHQJOAEHNW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClO4
Molecular weight214.60 g/mol
IUPAC name3-(2-chloro-5-hydroxyphenyl)-2-oxopropanoic acid
InChIKeyJFPSFHQJOAEHNW-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1O)CC(=O)C(=O)O)Cl

Computed by PubChem (NCBI)